C18H15NO5S — CID 6488457
ethyl 2-[4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate (PubChem CID 6488457) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6488457 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | ethyl 2-[4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2/N=C(c3cccs3)OC2=O)cc1 |
| InChI | InChI=1S/C18H15NO5S/c1-2-22-16(20)11-23-13-7-5-12(6-8-13)10-14-18(21)24-17(19-14)15-4-3-9-25-15/h3-10H,2,11H2,1H3/b14-10+ |
| InChIKey | SPLAOOCLHAJLMO-GXDHUFHOSA-N |
| XLogP | 3.03 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|