C19H16N2O4 — CID 92964181
2-[4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide (PubChem CID 92964181) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 92964181 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(C2=N/C(=C/c3ccc(OCC(N)=O)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-12-2-6-14(7-3-12)18-21-16(19(23)25-18)10-13-4-8-15(9-5-13)24-11-17(20)22/h2-10H,11H2,1H3,(H2,20,22)/b16-10+ |
| InChIKey | IKXKXZQKJJGNIF-MHWRWJLKSA-N |
| XLogP | 2.20 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|