C16H12N2O4S — CID 833948
2-[4-[(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetamide (PubChem CID 833948) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[4-[(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 833948 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[4-[(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(C=C2N=C(c3cccs3)OC2=O)cc1 |
| InChI | InChI=1S/C16H12N2O4S/c17-14(19)9-21-11-5-3-10(4-6-11)8-12-16(20)22-15(18-12)13-2-1-7-23-13/h1-8H,9H2,(H2,17,19) |
| InChIKey | QRGJMHMKSYRGHH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|