C17H15NO3S — CID 108937063
(4E)-4-[(4-propan-2-yloxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 108937063) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (4E)-4-[(4-propan-2-yloxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(4-propan-2-yloxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108937063 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (4E)-4-[(4-propan-2-yloxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | CC(C)Oc1ccc(/C=C2/N=C(c3cccs3)OC2=O)cc1 |
| InChI | InChI=1S/C17H15NO3S/c1-11(2)20-13-7-5-12(6-8-13)10-14-17(19)21-16(18-14)15-4-3-9-22-15/h3-11H,1-2H3/b14-10+ |
| InChIKey | HGZGBVLRXXFKEU-GXDHUFHOSA-N |
| XLogP | 3.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|