C15H11NO3S — CID 840009
(4Z)-4-[(4-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 840009) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is (4Z)-4-[(4-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 840009 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (4Z)-4-[(4-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | COc1ccc(/C=C2\N=C(c3cccs3)OC2=O)cc1 |
| InChI | InChI=1S/C15H11NO3S/c1-18-11-6-4-10(5-7-11)9-12-15(17)19-14(16-12)13-3-2-8-20-13/h2-9H,1H3/b12-9- |
| InChIKey | GLOSRCHFMWWHTR-XFXZXTDPSA-N |
| XLogP | 3.10 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|