C16H15NO4S — CID 159912770
methanol;(4E)-4-[(3-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 159912770) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is methanol;(4E)-4-[(3-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | methanol;(4E)-4-[(3-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 159912770 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | methanol;(4E)-4-[(3-methoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | CO.COc1cccc(/C=C2/N=C(c3cccs3)OC2=O)c1 |
| InChI | InChI=1S/C15H11NO3S.CH4O/c1-18-11-5-2-4-10(8-11)9-12-15(17)19-14(16-12)13-6-3-7-20-13;1-2/h2-9H,1H3;2H,1H3/b12-9+; |
| InChIKey | NXJSYHVZZWKFII-NBYYMMLRSA-N |
| XLogP | 2.71 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|