C23H19NO2 — CID 3106315
2-naphthalen-1-yl-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3106315) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-naphthalen-1-yl-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-naphthalen-1-yl-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3106315 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-naphthalen-1-yl-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)c1ccc(C=C2N=C(c3cccc4ccccc34)OC2=O)cc1 |
| InChI | InChI=1S/C23H19NO2/c1-15(2)17-12-10-16(11-13-17)14-21-23(25)26-22(24-21)20-9-5-7-18-6-3-4-8-19(18)20/h3-15H,1-2H3 |
| InChIKey | CIYSKMWPYWCMEO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|