C24H33NO3SSi — CID 11212940
N-[2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]phenyl]-4-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 11212940) has the molecular formula C24H33NO3SSi and a molecular weight of 443.69 g/mol. Its IUPAC name is N-[2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]phenyl]-4-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]phenyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 11212940 |
| Molecular Formula | C24H33NO3SSi |
| Molecular Weight | 443.69 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]phenyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1C(=C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33NO3SSi/c1-9-18-25(29(26,27)21-16-14-19(2)15-17-21)23-13-11-10-12-22(23)20(3)28-30(7,8)24(4,5)6/h9-17H,1,3,18H2,2,4-8H3 |
| InChIKey | AYJNJJXZVCQDTA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|