C21H22BrNO4S — CID 11705349
ethyl (E)-2-bromo-3-[2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]phenyl]prop-2-enoate (PubChem CID 11705349) has the molecular formula C21H22BrNO4S and a molecular weight of 464.38 g/mol. Its IUPAC name is ethyl (E)-2-bromo-3-[2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-bromo-3-[2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11705349 |
| Molecular Formula | C21H22BrNO4S |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | ethyl (E)-2-bromo-3-[2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]phenyl]prop-2-enoate |
| SMILES | C=CCN(c1ccccc1/C=C(/Br)C(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22BrNO4S/c1-4-14-23(28(25,26)18-12-10-16(3)11-13-18)20-9-7-6-8-17(20)15-19(22)21(24)27-5-2/h4,6-13,15H,1,5,14H2,2-3H3/b19-15+ |
| InChIKey | MQKIWBTXGKVTQV-XDJHFCHBSA-N |
| XLogP | 4.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|