C19H18N2O3S — CID 101458711
4-methyl-N-(3-phenyl-1,2-oxazol-5-yl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 101458711) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 4-methyl-N-(3-phenyl-1,2-oxazol-5-yl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-(3-phenyl-1,2-oxazol-5-yl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 101458711 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-methyl-N-(3-phenyl-1,2-oxazol-5-yl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1cc(-c2ccccc2)no1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-3-13-21(25(22,23)17-11-9-15(2)10-12-17)19-14-18(20-24-19)16-7-5-4-6-8-16/h3-12,14H,1,13H2,2H3 |
| InChIKey | AAZRIVUAGXEWHN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|