C21H25NO4S — CID 102356550
tert-butyl N-(4-methylphenyl)sulfonyl-N-(2-prop-2-enylphenyl)carbamate (PubChem CID 102356550) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is tert-butyl N-(4-methylphenyl)sulfonyl-N-(2-prop-2-enylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-(2-prop-2-enylphenyl)carbamate |
|---|---|
| PubChem CID | 102356550 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-(2-prop-2-enylphenyl)carbamate |
| SMILES | C=CCc1ccccc1N(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-6-9-17-10-7-8-11-19(17)22(20(23)26-21(3,4)5)27(24,25)18-14-12-16(2)13-15-18/h6-8,10-15H,1,9H2,2-5H3 |
| InChIKey | CWFPXVJZPVPPLU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|