C23H28N2O5S — CID 102342111
tert-butyl N-[(4-methylphenyl)sulfonylcarbamoyl]-N-(1-phenylbut-3-enyl)carbamate (PubChem CID 102342111) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is tert-butyl N-[(4-methylphenyl)sulfonylcarbamoyl]-N-(1-phenylbut-3-enyl)carbamate.
| Compound Name | tert-butyl N-[(4-methylphenyl)sulfonylcarbamoyl]-N-(1-phenylbut-3-enyl)carbamate |
|---|---|
| PubChem CID | 102342111 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | tert-butyl N-[(4-methylphenyl)sulfonylcarbamoyl]-N-(1-phenylbut-3-enyl)carbamate |
| SMILES | C=CCC(c1ccccc1)N(C(=O)NS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28N2O5S/c1-6-10-20(18-11-8-7-9-12-18)25(22(27)30-23(3,4)5)21(26)24-31(28,29)19-15-13-17(2)14-16-19/h6-9,11-16,20H,1,10H2,2-5H3,(H,24,26) |
| InChIKey | FUTVUHVTLKDFQL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|