C24H31NO5S — CID 11554109
tert-butyl (E)-5-[[(1S)-2-hydroxy-1-phenylethyl]-(4-methylphenyl)sulfonylamino]pent-2-enoate (PubChem CID 11554109) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is tert-butyl (E)-5-[[(1S)-2-hydroxy-1-phenylethyl]-(4-methylphenyl)sulfonylamino]pent-2-enoate.
| Compound Name | tert-butyl (E)-5-[[(1S)-2-hydroxy-1-phenylethyl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 11554109 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | tert-butyl (E)-5-[[(1S)-2-hydroxy-1-phenylethyl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC/C=C/C(=O)OC(C)(C)C)[C@H](CO)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-19-13-15-21(16-14-19)31(28,29)25(22(18-26)20-10-6-5-7-11-20)17-9-8-12-23(27)30-24(2,3)4/h5-8,10-16,22,26H,9,17-18H2,1-4H3/b12-8+/t22-/m1/s1 |
| InChIKey | IDVVCZOXWOQHJF-QWDXWUACSA-N |
| XLogP | 4.01 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|