C21H32BrNO4S — CID 11306016
tert-butyl (E)-5-[[(2S)-1-bromo-3-methylbutan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate (PubChem CID 11306016) has the molecular formula C21H32BrNO4S and a molecular weight of 474.46 g/mol. Its IUPAC name is tert-butyl (E)-5-[[(2S)-1-bromo-3-methylbutan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate.
| Compound Name | tert-butyl (E)-5-[[(2S)-1-bromo-3-methylbutan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 11306016 |
| Molecular Formula | C21H32BrNO4S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | tert-butyl (E)-5-[[(2S)-1-bromo-3-methylbutan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC/C=C/C(=O)OC(C)(C)C)[C@H](CBr)C(C)C)cc1 |
| InChI | InChI=1S/C21H32BrNO4S/c1-16(2)19(15-22)23(14-8-7-9-20(24)27-21(4,5)6)28(25,26)18-12-10-17(3)11-13-18/h7,9-13,16,19H,8,14-15H2,1-6H3/b9-7+/t19-/m1/s1 |
| InChIKey | BGBATJPXBULBBI-QRBZPYHOSA-N |
| XLogP | 4.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|