C19H29NO5S — CID 11269091
tert-butyl (E)-5-[[(2S)-1-hydroxypropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate (PubChem CID 11269091) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl (E)-5-[[(2S)-1-hydroxypropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate.
| Compound Name | tert-butyl (E)-5-[[(2S)-1-hydroxypropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 11269091 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl (E)-5-[[(2S)-1-hydroxypropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC/C=C/C(=O)OC(C)(C)C)[C@@H](C)CO)cc1 |
| InChI | InChI=1S/C19H29NO5S/c1-15-9-11-17(12-10-15)26(23,24)20(16(2)14-21)13-7-6-8-18(22)25-19(3,4)5/h6,8-12,16,21H,7,13-14H2,1-5H3/b8-6+/t16-/m0/s1 |
| InChIKey | YOMFNSHHKSMYQW-BVBGJJFLSA-N |
| XLogP | 2.65 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|