C15H29NO2 — CID 144846085
tert-butyl (Z)-5-[propan-2-yl(propyl)amino]pent-2-enoate (PubChem CID 144846085) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is tert-butyl (Z)-5-[propan-2-yl(propyl)amino]pent-2-enoate.
| Compound Name | tert-butyl (Z)-5-[propan-2-yl(propyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 144846085 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | tert-butyl (Z)-5-[propan-2-yl(propyl)amino]pent-2-enoate |
| SMILES | CCCN(CC/C=C\C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H29NO2/c1-7-11-16(13(2)3)12-9-8-10-14(17)18-15(4,5)6/h8,10,13H,7,9,11-12H2,1-6H3/b10-8- |
| InChIKey | PMWWQXFRUQJUJE-NTMALXAHSA-N |
| XLogP | 3.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|