C19H28BrNO4S — CID 11442207
tert-butyl (Z)-5-[[(2S)-1-bromopropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate (PubChem CID 11442207) has the molecular formula C19H28BrNO4S and a molecular weight of 446.41 g/mol. Its IUPAC name is tert-butyl (Z)-5-[[(2S)-1-bromopropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate.
| Compound Name | tert-butyl (Z)-5-[[(2S)-1-bromopropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 11442207 |
| Molecular Formula | C19H28BrNO4S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | tert-butyl (Z)-5-[[(2S)-1-bromopropan-2-yl]-(4-methylphenyl)sulfonylamino]pent-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC/C=C\C(=O)OC(C)(C)C)[C@@H](C)CBr)cc1 |
| InChI | InChI=1S/C19H28BrNO4S/c1-15-9-11-17(12-10-15)26(23,24)21(16(2)14-20)13-7-6-8-18(22)25-19(3,4)5/h6,8-12,16H,7,13-14H2,1-5H3/b8-6-/t16-/m0/s1 |
| InChIKey | VUDQHFGVYPFZNW-IOBAAEILSA-N |
| XLogP | 4.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|