C18H25NO6S — CID 10596129
methyl (Z)-5-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-2-enoate (PubChem CID 10596129) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl (Z)-5-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-2-enoate.
| Compound Name | methyl (Z)-5-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 10596129 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | methyl (Z)-5-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-2-enoate |
| SMILES | COC(=O)/C=C\CCN(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO6S/c1-14-9-11-15(12-10-14)26(22,23)19(17(21)25-18(2,3)4)13-7-6-8-16(20)24-5/h6,8-12H,7,13H2,1-5H3/b8-6- |
| InChIKey | HYMHOCMCMRBWDW-VURMDHGXSA-N |
| XLogP | 3.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|