C28H49NO5SSi2 — CID 11330537
tert-butyl N-[(E,3Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)hex-5-enyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 11330537) has the molecular formula C28H49NO5SSi2 and a molecular weight of 567.94 g/mol. Its IUPAC name is tert-butyl N-[(E,3Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)hex-5-enyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[(E,3Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)hex-5-enyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 11330537 |
| Molecular Formula | C28H49NO5SSi2 |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | tert-butyl N-[(E,3Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)hex-5-enyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC/C(=C\[Si](C)(C)C)C/C=C/O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H49NO5SSi2/c1-23-15-17-25(18-16-23)35(31,32)29(26(30)34-27(2,3)4)20-19-24(22-36(8,9)10)14-13-21-33-37(11,12)28(5,6)7/h13,15-18,21-22H,14,19-20H2,1-12H3/b21-13+,24-22- |
| InChIKey | MSYQGNUAPVMHGD-DGJSYRLFSA-N |
| XLogP | 8.04 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|