C23H35NO6S — CID 10551649
tert-butyl N-[4-(diethoxymethyl)hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 10551649) has the molecular formula C23H35NO6S and a molecular weight of 453.60 g/mol. Its IUPAC name is tert-butyl N-[4-(diethoxymethyl)hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[4-(diethoxymethyl)hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 10551649 |
| Molecular Formula | C23H35NO6S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | tert-butyl N-[4-(diethoxymethyl)hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | C#CC(CCCN(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1)C(OCC)OCC |
| InChI | InChI=1S/C23H35NO6S/c1-8-19(21(28-9-2)29-10-3)12-11-17-24(22(25)30-23(5,6)7)31(26,27)20-15-13-18(4)14-16-20/h1,13-16,19,21H,9-12,17H2,2-7H3 |
| InChIKey | KIHQLAAYNHHEBN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|