C26H43NO5SSi — CID 10767988
tert-butyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 10767988) has the molecular formula C26H43NO5SSi and a molecular weight of 509.79 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 10767988 |
| Molecular Formula | C26H43NO5SSi |
| Molecular Weight | 509.79 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | tert-butyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ynyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | C#CC(CCCN(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H43NO5SSi/c1-11-22(18-20-31-34(9,10)26(6,7)8)13-12-19-27(24(28)32-25(3,4)5)33(29,30)23-16-14-21(2)15-17-23/h1,14-17,22H,12-13,18-20H2,2-10H3 |
| InChIKey | ZIUWRLZUAJHEMM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.79 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|