C21H37NO3Si — CID 67539980
tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-N-phenylcarbamate (PubChem CID 67539980) has the molecular formula C21H37NO3Si and a molecular weight of 379.62 g/mol. Its IUPAC name is tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 67539980 |
| Molecular Formula | C21H37NO3Si |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H37NO3Si/c1-20(2,3)25-19(23)22(18-14-10-9-11-15-18)16-12-13-17-24-26(7,8)21(4,5)6/h9-11,14-15H,12-13,16-17H2,1-8H3 |
| InChIKey | SCXCSUDJCPJETM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|