C19H34N2O5SSi — CID 175572842
2-[4-[tert-butyl(dimethyl)silyl]oxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 175572842) has the molecular formula C19H34N2O5SSi and a molecular weight of 430.64 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175572842 |
| Molecular Formula | C19H34N2O5SSi |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCO[Si](C)(C)C(C)(C)C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C19H34N2O5SSi/c1-18(2,3)26-17(24)21(16-20-14(13-27-16)15(22)23)11-9-10-12-25-28(7,8)19(4,5)6/h13H,9-12H2,1-8H3,(H,22,23) |
| InChIKey | QOEHBAZCUWZQGA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|