C32H56N2O6SSi — CID 174159031
ethyl 2-[1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-[hex-5-ynyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 174159031) has the molecular formula C32H56N2O6SSi and a molecular weight of 624.96 g/mol. Its IUPAC name is ethyl 2-[1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-[hex-5-ynyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-[hex-5-ynyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 174159031 |
| Molecular Formula | C32H56N2O6SSi |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 624.36 |
| IUPAC Name | ethyl 2-[1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-[hex-5-ynyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | C#CCCCCN(C(=O)OC(C)(C)C)C(CC(OCCCO[Si](C)(C)C(C)(C)C)c1nc(C(=O)OCC)cs1)C(C)C |
| InChI | InChI=1S/C32H56N2O6SSi/c1-13-15-16-17-19-34(30(36)40-31(5,6)7)26(24(3)4)22-27(28-33-25(23-41-28)29(35)37-14-2)38-20-18-21-39-42(11,12)32(8,9)10/h1,23-24,26-27H,14-22H2,2-12H3 |
| InChIKey | KTYXTIIZGXQCJY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|