C30H53N3O4SSi — CID 156904111
ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-hex-5-ynylamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 156904111) has the molecular formula C30H53N3O4SSi and a molecular weight of 579.92 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-hex-5-ynylamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-hex-5-ynylamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 156904111 |
| Molecular Formula | C30H53N3O4SSi |
| Molecular Weight | 579.92 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-hex-5-ynylamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | C#CCCCCN(C(=O)[C@@H](N)[C@@H](C)CC)[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)c1nc(C(=O)OCC)cs1)C(C)C |
| InChI | InChI=1S/C30H53N3O4SSi/c1-12-15-16-17-18-33(28(34)26(31)22(6)13-2)24(21(4)5)19-25(37-39(10,11)30(7,8)9)27-32-23(20-38-27)29(35)36-14-3/h1,20-22,24-26H,13-19,31H2,2-11H3/t22-,24+,25+,26-/m0/s1 |
| InChIKey | KDSGTDZFNFNHRB-CDCCBSOTSA-N |
| XLogP | 6.80 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.92 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|