C22H33N3O4S — CID 166699642
ethyl 2-[(1R,3R)-3-[[(2R,3S)-3-ethyl-2-methanimidoylpent-4-ynoyl]-methylamino]-1-methoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 166699642) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-[[(2R,3S)-3-ethyl-2-methanimidoylpent-4-ynoyl]-methylamino]-1-methoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(1R,3R)-3-[[(2R,3S)-3-ethyl-2-methanimidoylpent-4-ynoyl]-methylamino]-1-methoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 166699642 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-[[(2R,3S)-3-ethyl-2-methanimidoylpent-4-ynoyl]-methylamino]-1-methoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | [H]/N=C/[C@H](C(=O)N(C)[C@H](C[C@@H](OC)c1nc(C(=O)OCC)cs1)C(C)C)[C@@H](C#C)CC |
| InChI | InChI=1S/C22H33N3O4S/c1-8-15(9-2)16(12-23)21(26)25(6)18(14(4)5)11-19(28-7)20-24-17(13-30-20)22(27)29-10-3/h1,12-16,18-19,23H,9-11H2,2-7H3/b23-12+/t15-,16-,18+,19+/m0/s1 |
| InChIKey | QVIFHYSJZLDZMV-UQYDKMANSA-N |
| XLogP | 3.81 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|