C23H39N5O5S — CID 123476735
ethyl 2-[(1R,3R)-3-[[(2S)-2-azido-3-methylpentanoyl]-propylamino]-1-(methoxymethoxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 123476735) has the molecular formula C23H39N5O5S and a molecular weight of 497.66 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-[[(2S)-2-azido-3-methylpentanoyl]-propylamino]-1-(methoxymethoxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(1R,3R)-3-[[(2S)-2-azido-3-methylpentanoyl]-propylamino]-1-(methoxymethoxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 123476735 |
| Molecular Formula | C23H39N5O5S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-[[(2S)-2-azido-3-methylpentanoyl]-propylamino]-1-(methoxymethoxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCN(C(=O)[C@@H](N=[N+]=[N-])C(C)CC)[C@H](C[C@@H](OCOC)c1nc(C(=O)OCC)cs1)C(C)C |
| InChI | InChI=1S/C23H39N5O5S/c1-8-11-28(22(29)20(26-27-24)16(6)9-2)18(15(4)5)12-19(33-14-31-7)21-25-17(13-34-21)23(30)32-10-3/h13,15-16,18-20H,8-12,14H2,1-7H3/t16?,18-,19-,20+/m1/s1 |
| InChIKey | OSFLKGOQMDSLLO-NLBBHCLQSA-N |
| XLogP | 5.36 |
| TPSA | 126.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|