C18H29N5O4S — CID 154980592
ethyl 2-[(1R,3R)-3-[[(3S)-2-azido-3-methylpentanoyl]amino]-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 154980592) has the molecular formula C18H29N5O4S and a molecular weight of 411.53 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-[[(3S)-2-azido-3-methylpentanoyl]amino]-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(1R,3R)-3-[[(3S)-2-azido-3-methylpentanoyl]amino]-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 154980592 |
| Molecular Formula | C18H29N5O4S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-[[(3S)-2-azido-3-methylpentanoyl]amino]-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc([C@H](O)C[C@@H](NC(=O)C(N=[N+]=[N-])[C@@H](C)CC)C(C)C)n1 |
| InChI | InChI=1S/C18H29N5O4S/c1-6-11(5)15(22-23-19)16(25)20-12(10(3)4)8-14(24)17-21-13(9-28-17)18(26)27-7-2/h9-12,14-15,24H,6-8H2,1-5H3,(H,20,25)/t11-,12+,14+,15?/m0/s1 |
| InChIKey | TVTPRSUAESFIMD-KCGXDXBQSA-N |
| XLogP | 3.61 |
| TPSA | 137.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|