C24H39N5O4S — CID 118667923
methyl 2-[(2R,4R)-4-[[(3S)-2-azido-3-methylpentanoyl]-(3-oxohexyl)amino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 118667923) has the molecular formula C24H39N5O4S and a molecular weight of 493.67 g/mol. Its IUPAC name is methyl 2-[(2R,4R)-4-[[(3S)-2-azido-3-methylpentanoyl]-(3-oxohexyl)amino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(2R,4R)-4-[[(3S)-2-azido-3-methylpentanoyl]-(3-oxohexyl)amino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 118667923 |
| Molecular Formula | C24H39N5O4S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | methyl 2-[(2R,4R)-4-[[(3S)-2-azido-3-methylpentanoyl]-(3-oxohexyl)amino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCC(=O)CCN(C(=O)C(N=[N+]=[N-])[C@@H](C)CC)[C@H](C[C@@H](C)c1nc(C(=O)OC)cs1)C(C)C |
| InChI | InChI=1S/C24H39N5O4S/c1-8-10-18(30)11-12-29(23(31)21(27-28-25)16(5)9-2)20(15(3)4)13-17(6)22-26-19(14-34-22)24(32)33-7/h14-17,20-21H,8-13H2,1-7H3/t16-,17+,20+,21?/m0/s1 |
| InChIKey | BNRXIRZIZQTIPK-OCOXFQHGSA-N |
| XLogP | 5.76 |
| TPSA | 125.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|