C21H33N5O5S — CID 58391058
ethyl 2-[3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(2-methoxyethyl)amino]-4-methylpentanoyl]-1,3-thiazole-4-carboxylate (PubChem CID 58391058) has the molecular formula C21H33N5O5S and a molecular weight of 467.59 g/mol. Its IUPAC name is ethyl 2-[3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(2-methoxyethyl)amino]-4-methylpentanoyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(2-methoxyethyl)amino]-4-methylpentanoyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 58391058 |
| Molecular Formula | C21H33N5O5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | ethyl 2-[3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(2-methoxyethyl)amino]-4-methylpentanoyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(=O)CC(C(C)C)N(CCOC)C(=O)[C@@H](N=[N+]=[N-])[C@@H](C)CC)n1 |
| InChI | InChI=1S/C21H33N5O5S/c1-7-14(5)18(24-25-22)20(28)26(9-10-30-6)16(13(3)4)11-17(27)19-23-15(12-32-19)21(29)31-8-2/h12-14,16,18H,7-11H2,1-6H3/t14-,16?,18-/m0/s1 |
| InChIKey | RRACWEMUZKBWNZ-NIQRUEKDSA-N |
| XLogP | 4.12 |
| TPSA | 134.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|