C19H31N5O4S — CID 134493209
methyl 2-[(1R,3R)-3-[(2-azido-3-methylpentanoyl)amino]-1-ethoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 134493209) has the molecular formula C19H31N5O4S and a molecular weight of 425.56 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-3-[(2-azido-3-methylpentanoyl)amino]-1-ethoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(1R,3R)-3-[(2-azido-3-methylpentanoyl)amino]-1-ethoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 134493209 |
| Molecular Formula | C19H31N5O4S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | methyl 2-[(1R,3R)-3-[(2-azido-3-methylpentanoyl)amino]-1-ethoxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCO[C@H](C[C@@H](NC(=O)C(N=[N+]=[N-])C(C)CC)C(C)C)c1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C19H31N5O4S/c1-7-12(5)16(23-24-20)17(25)21-13(11(3)4)9-15(28-8-2)18-22-14(10-29-18)19(26)27-6/h10-13,15-16H,7-9H2,1-6H3,(H,21,25)/t12?,13-,15-,16?/m1/s1 |
| InChIKey | NWSRLJTZJQROOO-RIALXRMPSA-N |
| XLogP | 4.26 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|