C18H32N2O3S — CID 168969089
2-[1-ethoxy-3-(hexylamino)-4-methylpentyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 168969089) has the molecular formula C18H32N2O3S and a molecular weight of 356.53 g/mol. Its IUPAC name is 2-[1-ethoxy-3-(hexylamino)-4-methylpentyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-ethoxy-3-(hexylamino)-4-methylpentyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 168969089 |
| Molecular Formula | C18H32N2O3S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-[1-ethoxy-3-(hexylamino)-4-methylpentyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCCCNC(CC(OCC)c1nc(C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C18H32N2O3S/c1-5-7-8-9-10-19-14(13(3)4)11-16(23-6-2)17-20-15(12-24-17)18(21)22/h12-14,16,19H,5-11H2,1-4H3,(H,21,22) |
| InChIKey | ILJCNAVDFRYVJF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|