C22H35N5O6S2 — CID 126559878
methyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(butanoyloxymethyl)amino]-4-methyl-1-sulfanyloxypentyl]-1,3-thiazole-4-carboxylate (PubChem CID 126559878) has the molecular formula C22H35N5O6S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(butanoyloxymethyl)amino]-4-methyl-1-sulfanyloxypentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(butanoyloxymethyl)amino]-4-methyl-1-sulfanyloxypentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 126559878 |
| Molecular Formula | C22H35N5O6S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | methyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-(butanoyloxymethyl)amino]-4-methyl-1-sulfanyloxypentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCC(=O)OCN(C(=O)[C@@H](N=[N+]=[N-])[C@@H](C)CC)[C@H](C[C@@H](OS)c1nc(C(=O)OC)cs1)C(C)C |
| InChI | InChI=1S/C22H35N5O6S2/c1-7-9-18(28)32-12-27(21(29)19(25-26-23)14(5)8-2)16(13(3)4)10-17(33-34)20-24-15(11-35-20)22(30)31-6/h11,13-14,16-17,19,34H,7-10,12H2,1-6H3/t14-,16+,17+,19-/m0/s1 |
| InChIKey | JREFKEJNVWMCMR-WFEDQXDTSA-N |
| XLogP | 5.10 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|