C29H49N5O5SSi — CID 156904089
ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-pent-4-ynoxyamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 156904089) has the molecular formula C29H49N5O5SSi and a molecular weight of 607.89 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-pent-4-ynoxyamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-pent-4-ynoxyamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 156904089 |
| Molecular Formula | C29H49N5O5SSi |
| Molecular Weight | 607.89 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-[[(2S,3S)-2-azido-3-methylpentanoyl]-pent-4-ynoxyamino]-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | C#CCCCON(C(=O)[C@@H](N=[N+]=[N-])[C@@H](C)CC)[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)c1nc(C(=O)OCC)cs1)C(C)C |
| InChI | InChI=1S/C29H49N5O5SSi/c1-12-15-16-17-38-34(27(35)25(32-33-30)21(6)13-2)23(20(4)5)18-24(39-41(10,11)29(7,8)9)26-31-22(19-40-26)28(36)37-14-3/h1,19-21,23-25H,13-18H2,2-11H3/t21-,23+,24+,25-/m0/s1 |
| InChIKey | RCNAICNDKCPCLA-QVQNZMNRSA-N |
| XLogP | 7.70 |
| TPSA | 126.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.89 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|