C22H37N3O5S — CID 163736921
2-[(1R,3R)-1-(methoxymethoxy)-4-methyl-3-[[(2S)-3-methyl-2-(methylideneamino)pentanoyl]-propylamino]pentyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 163736921) has the molecular formula C22H37N3O5S and a molecular weight of 455.62 g/mol. Its IUPAC name is 2-[(1R,3R)-1-(methoxymethoxy)-4-methyl-3-[[(2S)-3-methyl-2-(methylideneamino)pentanoyl]-propylamino]pentyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(1R,3R)-1-(methoxymethoxy)-4-methyl-3-[[(2S)-3-methyl-2-(methylideneamino)pentanoyl]-propylamino]pentyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 163736921 |
| Molecular Formula | C22H37N3O5S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-[(1R,3R)-1-(methoxymethoxy)-4-methyl-3-[[(2S)-3-methyl-2-(methylideneamino)pentanoyl]-propylamino]pentyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C=N[C@H](C(=O)N(CCC)[C@H](C[C@@H](OCOC)c1nc(C(=O)O)cs1)C(C)C)C(C)CC |
| InChI | InChI=1S/C22H37N3O5S/c1-8-10-25(21(26)19(23-6)15(5)9-2)17(14(3)4)11-18(30-13-29-7)20-24-16(12-31-20)22(27)28/h12,14-15,17-19H,6,8-11,13H2,1-5,7H3,(H,27,28)/t15?,17-,18-,19+/m1/s1 |
| InChIKey | LEKUXSGSLOGYFD-OTHOMEOQSA-N |
| XLogP | 4.27 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|