C24H32N4O4S — CID 160686568
benzyl 2-[(1R,3S,7S)-6-azido-1-hydroxy-7-methyl-5-oxo-3-propan-2-ylnonyl]-1,3-thiazole-4-carboxylate (PubChem CID 160686568) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is benzyl 2-[(1R,3S,7S)-6-azido-1-hydroxy-7-methyl-5-oxo-3-propan-2-ylnonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | benzyl 2-[(1R,3S,7S)-6-azido-1-hydroxy-7-methyl-5-oxo-3-propan-2-ylnonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 160686568 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | benzyl 2-[(1R,3S,7S)-6-azido-1-hydroxy-7-methyl-5-oxo-3-propan-2-ylnonyl]-1,3-thiazole-4-carboxylate |
| SMILES | CC[C@H](C)C(N=[N+]=[N-])C(=O)C[C@H](C[C@@H](O)c1nc(C(=O)OCc2ccccc2)cs1)C(C)C |
| InChI | InChI=1S/C24H32N4O4S/c1-5-16(4)22(27-28-25)20(29)11-18(15(2)3)12-21(30)23-26-19(14-33-23)24(31)32-13-17-9-7-6-8-10-17/h6-10,14-16,18,21-22,30H,5,11-13H2,1-4H3/t16-,18+,21+,22?/m0/s1 |
| InChIKey | NUJYVMCNQZEOGE-FDXPTNAVSA-N |
| XLogP | 5.88 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|