C18H40N2O3Si — CID 58080821
tert-butyl N-[(2S)-2-aminopropyl]-N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate (PubChem CID 58080821) has the molecular formula C18H40N2O3Si and a molecular weight of 360.62 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-aminopropyl]-N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-aminopropyl]-N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate |
|---|---|
| PubChem CID | 58080821 |
| Molecular Formula | C18H40N2O3Si |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | tert-butyl N-[(2S)-2-aminopropyl]-N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate |
| SMILES | C[C@H](N)CN(CCCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H40N2O3Si/c1-15(19)14-20(16(21)23-17(2,3)4)12-10-11-13-22-24(8,9)18(5,6)7/h15H,10-14,19H2,1-9H3/t15-/m0/s1 |
| InChIKey | APZJFWXETWWXBN-HNNXBMFYSA-N |
| XLogP | 4.37 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|