C15H24N2O2SSi — CID 140875114
2-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]-1,3-thiazole-4-carboxamide (PubChem CID 140875114) has the molecular formula C15H24N2O2SSi and a molecular weight of 324.52 g/mol. Its IUPAC name is 2-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 140875114 |
| Molecular Formula | C15H24N2O2SSi |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC#Cc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C15H24N2O2SSi/c1-15(2,3)21(4,5)19-10-8-6-7-9-13-17-12(11-20-13)14(16)18/h11H,6,8,10H2,1-5H3,(H2,16,18) |
| InChIKey | YIUOESNJQJNGGA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|