C10H24N2OSSi — CID 155592862
3-[tert-butyl(dimethyl)silyl]oxypropylthiourea (PubChem CID 155592862) has the molecular formula C10H24N2OSSi and a molecular weight of 248.47 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypropylthiourea.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypropylthiourea |
|---|---|
| PubChem CID | 155592862 |
| Molecular Formula | C10H24N2OSSi |
| Molecular Weight | 248.47 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypropylthiourea |
| SMILES | CC(C)(C)[Si](C)(C)OCCCNC(N)=S |
| InChI | InChI=1S/C10H24N2OSSi/c1-10(2,3)15(4,5)13-8-6-7-12-9(11)14/h6-8H2,1-5H3,(H3,11,12,14) |
| InChIKey | DDAHDVSBRUAREG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|