C27H46O4Si2 — CID 59615928
methyl 6-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]hex-5-ynoate (PubChem CID 59615928) has the molecular formula C27H46O4Si2 and a molecular weight of 490.83 g/mol. Its IUPAC name is methyl 6-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]hex-5-ynoate.
| Compound Name | methyl 6-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 59615928 |
| Molecular Formula | C27H46O4Si2 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | methyl 6-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1cc(CO[Si](C)(C)C(C)(C)C)cc(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C27H46O4Si2/c1-26(2,3)32(8,9)30-20-23-17-22(15-13-12-14-16-25(28)29-7)18-24(19-23)21-31-33(10,11)27(4,5)6/h17-19H,12,14,16,20-21H2,1-11H3 |
| InChIKey | CSRNFBQSTAUKMN-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|