C23H30FN3O6 — CID 155189035
methyl 6-[3-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]-5-fluorophenyl]hex-5-ynoate (PubChem CID 155189035) has the molecular formula C23H30FN3O6 and a molecular weight of 463.51 g/mol. Its IUPAC name is methyl 6-[3-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]-5-fluorophenyl]hex-5-ynoate.
| Compound Name | methyl 6-[3-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]-5-fluorophenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 155189035 |
| Molecular Formula | C23H30FN3O6 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | methyl 6-[3-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]-5-fluorophenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1cc(F)cc(NC(=O)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H30FN3O6/c1-23(2,3)33-22(31)27-18(10-11-19(25)28)21(30)26-17-13-15(12-16(24)14-17)8-6-5-7-9-20(29)32-4/h12-14,18H,5,7,9-11H2,1-4H3,(H2,25,28)(H,26,30)(H,27,31)/t18-/m0/s1 |
| InChIKey | WHSWWTOYZNEIKS-SFHVURJKSA-N |
| XLogP | 2.62 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|