C8H6N2O3S — CID 170472783
2-(4-amino-4-oxobut-1-ynyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 170472783) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-(4-amino-4-oxobut-1-ynyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(4-amino-4-oxobut-1-ynyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 170472783 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-(4-amino-4-oxobut-1-ynyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | NC(=O)CC#Cc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C8H6N2O3S/c9-6(11)2-1-3-7-10-5(4-14-7)8(12)13/h4H,2H2,(H2,9,11)(H,12,13) |
| InChIKey | REKWYAYGYLZDSN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|