2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid

C13H13N3O3S — CID 66373956

IUPAC2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid
SMILESNC(=O)c1ccccc1NCCc1nc(C(=O)O)cs1
InChIInChI=1S/C13H13N3O3S/c14-12(17)8-3-1-2-4-9(8)15-6-5-11-16-10(7-20-11)13(18)19/h1-4,7,15H,5-6H2,(H2,14,17)(H,18,19)
InChIKeyQJWRDPJBSIIZNT-UHFFFAOYSA-N
MW291.33 g/mol
LogP1.59
Rot. Bonds6

About 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid

2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66373956) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid
PubChem CID66373956
Molecular FormulaC13H13N3O3S
Molecular Weight291.33 g/mol
Exact Mass291.07
IUPAC Name2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid
SMILESNC(=O)c1ccccc1NCCc1nc(C(=O)O)cs1
InChIInChI=1S/C13H13N3O3S/c14-12(17)8-3-1-2-4-9(8)15-6-5-11-16-10(7-20-11)13(18)19/h1-4,7,15H,5-6H2,(H2,14,17)(H,18,19)
InChIKeyQJWRDPJBSIIZNT-UHFFFAOYSA-N
XLogP1.59
TPSA105.31 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.33
LogP ≤ 51.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid (CID 66373956) is 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid is NC(=O)c1ccccc1NCCc1nc(C(=O)O)cs1.
What is the InChIKey of 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is QJWRDPJBSIIZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3S/c14-12(17)8-3-1-2-4-9(8)15-6-5-11-16-10(7-20-11)13(18)19/h1-4,7,15H,5-6H2,(H2,14,17)(H,18,19).
What are the key properties of 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid?
2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 291.33 g/mol, XLogP of 1.59, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-carbamoylanilino)ethyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 66373956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).