C12H12N2O4S2 — CID 66374307
2-[2-(benzenesulfonamido)ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66374307) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-(benzenesulfonamido)ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66374307 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[2-(benzenesulfonamido)ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(CCNS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C12H12N2O4S2/c15-12(16)10-8-19-11(14-10)6-7-13-20(17,18)9-4-2-1-3-5-9/h1-5,8,13H,6-7H2,(H,15,16) |
| InChIKey | QETMCHQDBRIDSH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |