C10H12N4O2S2 — CID 92659518
N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 92659518) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 92659518 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1nnc(CCNS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C10H12N4O2S2/c11-10-14-13-9(17-10)6-7-12-18(15,16)8-4-2-1-3-5-8/h1-5,12H,6-7H2,(H2,11,14) |
| InChIKey | SYDVENCEJWQOCQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |