C13H14N4OS — CID 91790359
(E)-N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 91790359) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is (E)-N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 91790359 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (E)-N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | Nc1nnc(CCNC(=O)/C=C/c2ccccc2)s1 |
| InChI | InChI=1S/C13H14N4OS/c14-13-17-16-12(19-13)8-9-15-11(18)7-6-10-4-2-1-3-5-10/h1-7H,8-9H2,(H2,14,17)(H,15,18)/b7-6+ |
| InChIKey | HWMFCTUHAVBAOV-VOTSOKGWSA-N |
| XLogP | 1.49 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|