C12H19N3O3S — CID 163486314
methyl 3-[2-(4-carbamoyl-1,3-thiazol-2-yl)ethylamino]-2,2-dimethylpropanoate (PubChem CID 163486314) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl 3-[2-(4-carbamoyl-1,3-thiazol-2-yl)ethylamino]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[2-(4-carbamoyl-1,3-thiazol-2-yl)ethylamino]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163486314 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 3-[2-(4-carbamoyl-1,3-thiazol-2-yl)ethylamino]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CNCCc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C12H19N3O3S/c1-12(2,11(17)18-3)7-14-5-4-9-15-8(6-19-9)10(13)16/h6,14H,4-5,7H2,1-3H3,(H2,13,16) |
| InChIKey | CIVQOOBVXZRIPO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|