C11H17N3O4S — CID 79291389
2-[2-[[2-(2-methoxyethylamino)acetyl]amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 79291389) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[2-[[2-(2-methoxyethylamino)acetyl]amino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[[2-(2-methoxyethylamino)acetyl]amino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79291389 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[2-[[2-(2-methoxyethylamino)acetyl]amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | COCCNCC(=O)NCCc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H17N3O4S/c1-18-5-4-12-6-9(15)13-3-2-10-14-8(7-19-10)11(16)17/h7,12H,2-6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | NSXFLUNVJKHFRN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|