About 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane
2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane (PubChem CID 70374539) has the molecular formula C23H37NO6
and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane.
Molecular Properties
| Compound Name | 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane |
| PubChem CID | 70374539 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane |
| SMILES | C1CCOCC1.C1CCOCC1.CC(C)(C)OC(=O)N(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO4.2C5H10O/c1-13(2,3)18-12(17)14(9-11(15)16)10-7-5-4-6-8-10;2*1-2-4-6-5-3-1/h4-8H,9H2,1-3H3,(H,15,16);2*1-5H2 |
| InChIKey | YSHBSEARTHSDGE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane?
The IUPAC name of 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane (CID 70374539) is 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane.
What is the SMILES notation for 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane?
The canonical SMILES for 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane is C1CCOCC1.C1CCOCC1.CC(C)(C)OC(=O)N(CC(=O)O)c1ccccc1.
What is the InChIKey of 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane?
The InChIKey is YSHBSEARTHSDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4.2C5H10O/c1-13(2,3)18-12(17)14(9-11(15)16)10-7-5-4-6-8-10;2*1-2-4-6-5-3-1/h4-8H,9H2,1-3H3,(H,15,16);2*1-5H2.
What are the key properties of 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane?
2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane has a molecular weight of 423.55 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetic acid;oxane is sourced from PubChem (CID 70374539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).