C22H17F17INO2 — CID 138973055
tert-butyl N-[(Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundec-2-enyl]-N-phenylcarbamate (PubChem CID 138973055) has the molecular formula C22H17F17INO2 and a molecular weight of 777.25 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundec-2-enyl]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[(Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundec-2-enyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 138973055 |
| Molecular Formula | C22H17F17INO2 |
| Molecular Weight | 777.25 g/mol |
| Exact Mass | 777.00 |
| IUPAC Name | tert-butyl N-[(Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundec-2-enyl]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C/C(I)=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H17F17INO2/c1-14(2,3)43-13(42)41(12-7-5-4-6-8-12)10-11(40)9-15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)22(37,38)39/h4-9H,10H2,1-3H3/b11-9- |
| InChIKey | IQYGHGUGMXPTDJ-LUAWRHEFSA-N |
| XLogP | 9.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.25 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|